loading...| Preferred Name |
naloxone |
| Synonyms |
naloxone naloxona 1-N-Allyl-14-hydroxynordihydromorphinone (-)-naloxone 17-allyl-3,14-dihydroxy-4,5alpha-epoxymorphinan-6-one naloxonum 3,14-dihydroxy-17-(prop-2-en-1-yl)-4,5alpha-epoxymorphinan-6-one |
| Definitions |
A synthetic morphinane alkaloid that is morphinone in which the enone double bond has been reduced to a single bond, the hydrogen at position 14 has been replaced by a hydroxy group, and the methyl group attached to the nitrogen has been replaced by an allyl group. A specific opioid antagonist, it is used (commonly as its hydrochloride salt) to reverse the effects of opioids, both following their use of opioids during surgery and in cases of known or suspected opioid overdose. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_7459 |
| charge |
0 |
| database_cross_reference |
Patent:GB939287 Beilstein:1089071 Wikipedia:Naloxone PMID:26604818 Patent:US3254088 DrugBank:DB01183 PMID:25468814 PMID:24868924 KEGG:D08249 KEGG:C07252 PMID:26634308 Reaxys:1089071 Drug_Central:1878 LINCS:LSM-3504 HMDB:HMDB0015314 PMID:26469689 PMID:17023477 CAS:465-65-6 |
| definition |
A synthetic morphinane alkaloid that is morphinone in which the enone double bond has been reduced to a single bond, the hydrogen at position 14 has been replaced by a hydroxy group, and the methyl group attached to the nitrogen has been replaced by an allyl group. A specific opioid antagonist, it is used (commonly as its hydrochloride salt) to reverse the effects of opioids, both following their use of opioids during surgery and in cases of known or suspected opioid overdose. |
| formula |
C19H21NO4 |
| has parent hydride | |
| has role |
http://purl.obolibrary.org/obo/CHEBI_50137 |
| has_exact_synonym |
3,14-dihydroxy-17-(prop-2-en-1-yl)-4,5alpha-epoxymorphinan-6-one |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
naloxone naloxona 1-N-Allyl-14-hydroxynordihydromorphinone (-)-naloxone 17-allyl-3,14-dihydroxy-4,5alpha-epoxymorphinan-6-one naloxonum |
| id |
CHEBI:7459 |
| in_subset | |
| inchi |
InChI=1S/C19H21NO4/c1-2-8-20-9-7-18-15-11-3-4-12(21)16(15)24-17(18)13(22)5-6-19(18,23)14(20)10-11/h2-4,14,17,21,23H,1,5-10H2/t14-,17+,18+,19-/m1/s1 |
| inchikey |
UZHSEJADLWPNLE-GRGSLBFTSA-N |
| is conjugate base of | |
| label |
naloxone |
| mass |
327.37430 |
| monoisotopicmass |
327.14706 |
| notation |
CHEBI:7459 |
| prefLabel |
naloxone |
| smiles |
Oc1ccc2C[C@H]3N(CC[C@@]45[C@@H](Oc1c24)C(=O)CC[C@@]35O)CC=C |
| treeView |
http://purl.obolibrary.org/obo/CHEBI_38164 |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_38164 |