| Preferred Name |
tryptamine |
| Synonyms |
2-(1H-INDOL-3-YL)ETHANAMINE 3-(2-Aminoethyl)indole Tryptamine 1H-indole-3-ethanamine 2-(3-indolyl)ethylamine 2-(1H-indol-3-yl)ethanamine |
| Definitions |
An aminoalkylindole consisting of indole having a 2-aminoethyl group at the 3-position. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_16765 |
| charge |
0 |
| database_cross_reference |
MetaCyc:TRYPTAMINE CAS:61-54-1 PMID:16126914 KNApSAcK:C00001434 PMID:22770225 PMID:24345948 PDBeChem:TSS DrugBank:DB08653 PMID:24558969 KEGG:C00398 Reaxys:125513 HMDB:HMDB0000303 Gmelin:603448 Wikipedia:Tryptamine Beilstein:125513 |
| definition |
An aminoalkylindole consisting of indole having a 2-aminoethyl group at the 3-position. |
| formula |
C10H12N2 |
| has exact synonym |
Tryptamine 2-(1H-indol-3-yl)ethanamine |
| has related synonym |
2-(1H-INDOL-3-YL)ETHANAMINE 3-(2-Aminoethyl)indole 1H-indole-3-ethanamine 2-(3-indolyl)ethylamine |
| has role |
http://purl.obolibrary.org/obo/CHEBI_75771 |
| has_alternative_id |
CHEBI:27161 CHEBI:46157 CHEBI:15274 CHEBI:9767 |
| has_obo_namespace |
chebi_ontology |
| id |
CHEBI:16765 |
| in_subset | |
| inchi |
InChI=1S/C10H12N2/c11-6-5-8-7-12-10-4-2-1-3-9(8)10/h1-4,7,12H,5-6,11H2 |
| inchikey |
APJYDQYYACXCRM-UHFFFAOYSA-N |
| is_conjugate_base_of | |
| label |
tryptamine |
| mass |
160.21570 |
| monoisotopicmass |
160.10005 |
| notation |
CHEBI:16765 |
| prefLabel |
tryptamine |
| smiles |
NCCc1c[nH]c2ccccc12 |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_64365 http://purl.obolibrary.org/obo/CHEBI_38631 |