loading...| Preferred Name |
bistratamide G |
| Synonyms |
(4S,11S,18S)-7-methyl-4,11,18-tri(propan-2-yl)-6,13-dioxa-20-thia-3,10,17,22,23,24-hexaazatetracyclo[17.2.1.1(5,8).1(12,15)12,15]tetracosa-1(21),5(24),7,12(23),14,19(22)-hexaene-2,9,16-trione |
| Definitions |
A homodetic cyclic peptide that consists of L-valine as the amino acid residue. It is isolated from Lissoclinum bistratum and exhibits antitumour activity against the human colon tumour cell line. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_65506 |
| charge |
0 |
| database_cross_reference |
Reaxys:9451867 PMID:12608858 Chemspider:10250990 |
| definition |
A homodetic cyclic peptide that consists of L-valine as the amino acid residue. It is isolated from Lissoclinum bistratum and exhibits antitumour activity against the human colon tumour cell line. |
| formula |
C25H32N6O5S |
| has role | |
| has_exact_synonym |
(4S,11S,18S)-7-methyl-4,11,18-tri(propan-2-yl)-6,13-dioxa-20-thia-3,10,17,22,23,24-hexaazatetracyclo[17.2.1.1(5,8).1(12,15)12,15]tetracosa-1(21),5(24),7,12(23),14,19(22)-hexaene-2,9,16-trione |
| has_obo_namespace |
chebi_ontology |
| id |
CHEBI:65506 |
| in_subset | |
| inchi |
InChI=1S/C25H32N6O5S/c1-10(2)16-23-26-14(8-35-23)20(32)30-18(12(5)6)25-27-15(9-37-25)21(33)28-17(11(3)4)24-31-19(13(7)36-24)22(34)29-16/h8-12,16-18H,1-7H3,(H,28,33)(H,29,34)(H,30,32)/t16-,17-,18-/m0/s1 |
| inchikey |
YDONFAWPMVOOTI-BZSNNMDCSA-N |
| label |
bistratamide G |
| mass |
528.62400 |
| monoisotopicmass |
528.21549 |
| notation |
CHEBI:65506 |
| prefLabel |
bistratamide G |
| smiles |
CC(C)[C@@H]1NC(=O)c2nc(oc2C)[C@@H](NC(=O)c2csc(n2)[C@@H](NC(=O)c2coc1n2)C(C)C)C(C)C |
| treeView | |
| subClassOf |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| There are currently no mappings for this class. | |||