loading...| Preferred Name |
aspartic acid |
| Synonyms |
Asp 2-aminobutanedioic acid (R,S)-Aspartic acid DL-Asparagic acid aspartic acid DL-Aminosuccinic acid Aspartic acid (+-)-Aspartic acid D |
| Definitions |
An alpha-amino acid that consists of succinic acid bearing a single alpha-amino substituent |
| ID |
http://purl.obolibrary.org/obo/CHEBI_22660 |
| charge |
0 |
| database_cross_reference |
Reaxys:774618 KEGG:C16433 Wikipedia:Aspartic_acid PMID:22264337 Gmelin:185140 Beilstein:774618 CAS:617-45-8 |
| formula |
C4H7NO4 |
| has exact synonym |
aspartic acid Aspartic acid |
| has role | |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
Asp 2-aminobutanedioic acid (R,S)-Aspartic acid DL-Asparagic acid DL-Aminosuccinic acid (+-)-Aspartic acid D |
| id |
CHEBI:22660 |
| imported from | |
| in subset | |
| inchi |
InChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9) |
| inchikey |
CKLJMWTZIZZHCS-UHFFFAOYSA-N |
| is conjugate acid of | |
| label |
aspartic acid |
| mass |
133.10272 |
| monoisotopicmass |
133.03751 |
| notation |
CHEBI:22660 |
| prefLabel |
aspartic acid |
| smiles |
NC(CC(O)=O)C(O)=O |
| textual definition |
An alpha-amino acid that consists of succinic acid bearing a single alpha-amino substituent |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_26167 |
| has_part |