loading...| Preferred Name |
chrysobactin |
| Synonyms |
N(2)-(2,3-dihydroxybenzoyl)-D-lysyl-L-serine 2-(2,3-dihydroxybenzoyl)-D-lysyl-L-serine |
| Definitions |
A catechol-type siderophore with a structure of D-lysyl-L-serine substituted on N(2) of the lysyl residue by a 2,3-dihydroxybenzoyl group. It is produced by the Gram-negative bacillus Dickeya dadantii (previously known as Erwinia chrysanthem). Only the catecholate hydroxyl groups participate in metal coordination, so chrysobactin cannot provide full 1:1 coordination of Fe(III); at neutral pH and concentrations of about 0.1 mM, ferric chrysobactin exists as a mixture of bis and tris complexes. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_61345 |
| charge |
0 |
| database_cross_reference |
PMID:1787788 PMID:12231882 PMID:18803373 CAS:120124-51-8 PMCID:PMC207143 MetaCyc:CPD-12582 PMID:1392469 PMID:8837459 |
| definition |
A catechol-type siderophore with a structure of D-lysyl-L-serine substituted on N(2) of the lysyl residue by a 2,3-dihydroxybenzoyl group. It is produced by the Gram-negative bacillus Dickeya dadantii (previously known as Erwinia chrysanthem). Only the catecholate hydroxyl groups participate in metal coordination, so chrysobactin cannot provide full 1:1 coordination of Fe(III); at neutral pH and concentrations of about 0.1 mM, ferric chrysobactin exists as a mixture of bis and tris complexes. |
| formula |
C16H23N3O7 |
| has role | |
| has_exact_synonym |
N(2)-(2,3-dihydroxybenzoyl)-D-lysyl-L-serine |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
2-(2,3-dihydroxybenzoyl)-D-lysyl-L-serine |
| id |
CHEBI:61345 |
| in_subset | |
| inchi |
InChI=1S/C16H23N3O7/c17-7-2-1-5-10(15(24)19-11(8-20)16(25)26)18-14(23)9-4-3-6-12(21)13(9)22/h3-4,6,10-11,20-22H,1-2,5,7-8,17H2,(H,18,23)(H,19,24)(H,25,26)/t10-,11+/m1/s1 |
| inchikey |
NNTXFOAPABMVEG-MNOVXSKESA-N |
| label |
chrysobactin |
| mass |
369.36970 |
| monoisotopicmass |
369.15360 |
| notation |
CHEBI:61345 |
| prefLabel |
chrysobactin |
| smiles |
NCCCC[C@@H](NC(=O)c1cccc(O)c1O)C(=O)N[C@@H](CO)C(O)=O |
| treeView |
http://purl.obolibrary.org/obo/CHEBI_25384 http://purl.obolibrary.org/obo/CHEBI_50994 http://purl.obolibrary.org/obo/CHEBI_46761 |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_25384 http://purl.obolibrary.org/obo/CHEBI_50994 http://purl.obolibrary.org/obo/CHEBI_46761 |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.bioontology.org/ontology/MESH/C058543 | Medical Subject Headings / 医学主题词表 | LOOM |